About 1-aminopropan-2-ol;ethanesulfonic acid
1-aminopropan-2-ol;ethanesulfonic acid (PubChem CID 20512936) has the molecular formula C5H15NO4S
and a molecular weight of 185.24 g/mol. Its IUPAC name is 1-aminopropan-2-ol;ethanesulfonic acid.
Molecular Properties
| Compound Name | 1-aminopropan-2-ol;ethanesulfonic acid |
| PubChem CID | 20512936 |
| Molecular Formula | C5H15NO4S |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 1-aminopropan-2-ol;ethanesulfonic acid |
| SMILES | CC(O)CN.CCS(=O)(=O)O |
| InChI | InChI=1S/C3H9NO.C2H6O3S/c1-3(5)2-4;1-2-6(3,4)5/h3,5H,2,4H2,1H3;2H2,1H3,(H,3,4,5) |
| InChIKey | VOFAYLSABGCLNS-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropan-2-ol;ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-ol;ethanesulfonic acid?
The IUPAC name of 1-aminopropan-2-ol;ethanesulfonic acid (CID 20512936) is 1-aminopropan-2-ol;ethanesulfonic acid.
What is the SMILES notation for 1-aminopropan-2-ol;ethanesulfonic acid?
The canonical SMILES for 1-aminopropan-2-ol;ethanesulfonic acid is CC(O)CN.CCS(=O)(=O)O.
What is the InChIKey of 1-aminopropan-2-ol;ethanesulfonic acid?
The InChIKey is VOFAYLSABGCLNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO.C2H6O3S/c1-3(5)2-4;1-2-6(3,4)5/h3,5H,2,4H2,1H3;2H2,1H3,(H,3,4,5).
What are the key properties of 1-aminopropan-2-ol;ethanesulfonic acid?
1-aminopropan-2-ol;ethanesulfonic acid has a molecular weight of 185.24 g/mol, XLogP of -0.78, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-ol;ethanesulfonic acid is sourced from PubChem (CID 20512936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).