1-aminopropan-2-ol;ethanesulfonic acid

C5H15NO4S — CID 20512936

IUPAC1-aminopropan-2-ol;ethanesulfonic acid
SMILESCC(O)CN.CCS(=O)(=O)O
InChIInChI=1S/C3H9NO.C2H6O3S/c1-3(5)2-4;1-2-6(3,4)5/h3,5H,2,4H2,1H3;2H2,1H3,(H,3,4,5)
InChIKeyVOFAYLSABGCLNS-UHFFFAOYSA-N
MW185.24 g/mol
LogP-0.78
Rot. Bonds2

About 1-aminopropan-2-ol;ethanesulfonic acid

1-aminopropan-2-ol;ethanesulfonic acid (PubChem CID 20512936) has the molecular formula C5H15NO4S and a molecular weight of 185.24 g/mol. Its IUPAC name is 1-aminopropan-2-ol;ethanesulfonic acid.

Molecular Properties

Compound Name1-aminopropan-2-ol;ethanesulfonic acid
PubChem CID20512936
Molecular FormulaC5H15NO4S
Molecular Weight185.24 g/mol
Exact Mass185.07
IUPAC Name1-aminopropan-2-ol;ethanesulfonic acid
SMILESCC(O)CN.CCS(=O)(=O)O
InChIInChI=1S/C3H9NO.C2H6O3S/c1-3(5)2-4;1-2-6(3,4)5/h3,5H,2,4H2,1H3;2H2,1H3,(H,3,4,5)
InChIKeyVOFAYLSABGCLNS-UHFFFAOYSA-N
XLogP-0.78
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.24
LogP ≤ 5-0.78
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1-aminopropan-2-ol;ethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-aminopropan-2-ol;ethanesulfonic acid?
The IUPAC name of 1-aminopropan-2-ol;ethanesulfonic acid (CID 20512936) is 1-aminopropan-2-ol;ethanesulfonic acid.
What is the SMILES notation for 1-aminopropan-2-ol;ethanesulfonic acid?
The canonical SMILES for 1-aminopropan-2-ol;ethanesulfonic acid is CC(O)CN.CCS(=O)(=O)O.
What is the InChIKey of 1-aminopropan-2-ol;ethanesulfonic acid?
The InChIKey is VOFAYLSABGCLNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO.C2H6O3S/c1-3(5)2-4;1-2-6(3,4)5/h3,5H,2,4H2,1H3;2H2,1H3,(H,3,4,5).
What are the key properties of 1-aminopropan-2-ol;ethanesulfonic acid?
1-aminopropan-2-ol;ethanesulfonic acid has a molecular weight of 185.24 g/mol, XLogP of -0.78, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-ol;ethanesulfonic acid is sourced from PubChem (CID 20512936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).