About bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane
bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane (PubChem CID 20512943) has the molecular formula C7H19NO7S
and a molecular weight of 261.30 g/mol. Its IUPAC name is bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane.
Molecular Properties
| Compound Name | bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane |
| PubChem CID | 20512943 |
| Molecular Formula | C7H19NO7S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane |
| SMILES | C.O=S(=O)(O)N(C(CO)CO)C(CO)CO |
| InChI | InChI=1S/C6H15NO7S.CH4/c8-1-5(2-9)7(15(12,13)14)6(3-10)4-11;/h5-6,8-11H,1-4H2,(H,12,13,14);1H4 |
| InChIKey | PXSWDXGABWBZHX-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane?
The IUPAC name of bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane (CID 20512943) is bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane.
What is the SMILES notation for bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane?
The canonical SMILES for bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane is C.O=S(=O)(O)N(C(CO)CO)C(CO)CO.
What is the InChIKey of bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane?
The InChIKey is PXSWDXGABWBZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO7S.CH4/c8-1-5(2-9)7(15(12,13)14)6(3-10)4-11;/h5-6,8-11H,1-4H2,(H,12,13,14);1H4.
What are the key properties of bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane?
bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane has a molecular weight of 261.30 g/mol, XLogP of -2.57, 7 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,3-dihydroxypropan-2-yl)sulfamic acid;methane is sourced from PubChem (CID 20512943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).