About 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline
4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline (PubChem CID 20512993) has the molecular formula C15H14BrCl2N3
and a molecular weight of 387.11 g/mol. Its IUPAC name is 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline.
Molecular Properties
| Compound Name | 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline |
| PubChem CID | 20512993 |
| Molecular Formula | C15H14BrCl2N3 |
| Molecular Weight | 387.11 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline |
| SMILES | CN(C)c1ccc(/C=N/c2c(Cl)cc(N)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C15H14BrCl2N3/c1-21(2)11-4-3-9(12(16)7-11)8-20-15-13(17)5-10(19)6-14(15)18/h3-8H,19H2,1-2H3/b20-8+ |
| InChIKey | BYCWVYKXGJQGCE-DNTJNYDQSA-N |
| XLogP | 5.15 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.11 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline?
The IUPAC name of 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline (CID 20512993) is 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline.
What is the SMILES notation for 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline?
The canonical SMILES for 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline is CN(C)c1ccc(/C=N/c2c(Cl)cc(N)cc2Cl)c(Br)c1.
What is the InChIKey of 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline?
The InChIKey is BYCWVYKXGJQGCE-DNTJNYDQSA-N. The full InChI is InChI=1S/C15H14BrCl2N3/c1-21(2)11-4-3-9(12(16)7-11)8-20-15-13(17)5-10(19)6-14(15)18/h3-8H,19H2,1-2H3/b20-8+.
What are the key properties of 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline?
4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline has a molecular weight of 387.11 g/mol, XLogP of 5.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-bromo-4-(dimethylamino)phenyl]methylideneamino]-3,5-dichloroaniline is sourced from PubChem (CID 20512993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).