About 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline
4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline (PubChem CID 20512996) has the molecular formula C13H9BrCl2N2
and a molecular weight of 344.04 g/mol. Its IUPAC name is 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline.
Molecular Properties
| Compound Name | 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline |
| PubChem CID | 20512996 |
| Molecular Formula | C13H9BrCl2N2 |
| Molecular Weight | 344.04 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline |
| SMILES | Nc1cc(Cl)c(/N=C/c2cccc(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C13H9BrCl2N2/c14-9-3-1-2-8(4-9)7-18-13-11(15)5-10(17)6-12(13)16/h1-7H,17H2/b18-7+ |
| InChIKey | VGCYCMGZUMSBRK-CNHKJKLMSA-N |
| XLogP | 5.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.04 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline?
The IUPAC name of 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline (CID 20512996) is 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline.
What is the SMILES notation for 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline?
The canonical SMILES for 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline is Nc1cc(Cl)c(/N=C/c2cccc(Br)c2)c(Cl)c1.
What is the InChIKey of 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline?
The InChIKey is VGCYCMGZUMSBRK-CNHKJKLMSA-N. The full InChI is InChI=1S/C13H9BrCl2N2/c14-9-3-1-2-8(4-9)7-18-13-11(15)5-10(17)6-12(13)16/h1-7H,17H2/b18-7+.
What are the key properties of 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline?
4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline has a molecular weight of 344.04 g/mol, XLogP of 5.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-bromophenyl)methylideneamino]-3,5-dichloroaniline is sourced from PubChem (CID 20512996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).