C13H15F7O3Si — CID 20513039
[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-triethoxysilane (PubChem CID 20513039) has the molecular formula C13H15F7O3Si and a molecular weight of 380.33 g/mol. Its IUPAC name is [difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-triethoxysilane.
| Compound Name | [difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-triethoxysilane |
|---|---|
| PubChem CID | 20513039 |
| Molecular Formula | C13H15F7O3Si |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-triethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)C(F)(F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H15F7O3Si/c1-4-21-24(22-5-2,23-6-3)13(19,20)7-8(14)10(16)12(18)11(17)9(7)15/h4-6H2,1-3H3 |
| InChIKey | UDGKZDNALOVGAY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|