C14H21F11O3Si — CID 20513043
tripropoxy(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silane (PubChem CID 20513043) has the molecular formula C14H21F11O3Si and a molecular weight of 474.38 g/mol. Its IUPAC name is tripropoxy(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silane.
| Compound Name | tripropoxy(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silane |
|---|---|
| PubChem CID | 20513043 |
| Molecular Formula | C14H21F11O3Si |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | tripropoxy(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)silane |
| SMILES | CCCO[Si](OCCC)(OCCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H21F11O3Si/c1-4-7-26-29(27-8-5-2,28-9-6-3)14(24,25)12(19,20)10(15,16)11(17,18)13(21,22)23/h4-9H2,1-3H3 |
| InChIKey | PIODKGMGEXABCY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|