C13H7N3 — CID 20513184
2,3,4-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene (PubChem CID 20513184) has the molecular formula C13H7N3 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2,3,4-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene.
| Compound Name | 2,3,4-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene |
|---|---|
| PubChem CID | 20513184 |
| Molecular Formula | C13H7N3 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2,3,4-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene |
| SMILES | c1ccc2c(c1)-c1cccc3nnnc-2c13 |
| InChI | InChI=1S/C13H7N3/c1-2-5-10-8(4-1)9-6-3-7-11-12(9)13(10)15-16-14-11/h1-7H |
| InChIKey | PKSCUUSRDSCNRK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |