C14H25N3O7S2 — CID 20513243
(5-ethyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinolin-7-yl)methyl methanesulfonate;sulfuric acid (PubChem CID 20513243) has the molecular formula C14H25N3O7S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is (5-ethyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinolin-7-yl)methyl methanesulfonate;sulfuric acid.
| Compound Name | (5-ethyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinolin-7-yl)methyl methanesulfonate;sulfuric acid |
|---|---|
| PubChem CID | 20513243 |
| Molecular Formula | C14H25N3O7S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (5-ethyl-1,4,4a,6,7,8,8a,9-octahydropyrazolo[5,4-g]quinolin-7-yl)methyl methanesulfonate;sulfuric acid |
| SMILES | CCN1CC(COS(C)(=O)=O)CC2Cc3[nH]ncc3CC21.O=S(=O)(O)O |
| InChI | InChI=1S/C14H23N3O3S.H2O4S/c1-3-17-8-10(9-20-21(2,18)19)4-11-5-13-12(6-14(11)17)7-15-16-13;1-5(2,3)4/h7,10-11,14H,3-6,8-9H2,1-2H3,(H,15,16);(H2,1,2,3,4) |
| InChIKey | TYSKIZLGOHBMPM-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 149.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|