C26H16Na2O6S2 — CID 20513746
disodium;9,10-diphenylanthracene-2,6-disulfonate (PubChem CID 20513746) has the molecular formula C26H16Na2O6S2 and a molecular weight of 534.52 g/mol. Its IUPAC name is disodium;9,10-diphenylanthracene-2,6-disulfonate.
| Compound Name | disodium;9,10-diphenylanthracene-2,6-disulfonate |
|---|---|
| PubChem CID | 20513746 |
| Molecular Formula | C26H16Na2O6S2 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | disodium;9,10-diphenylanthracene-2,6-disulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(-c3ccccc3)c3cc(S(=O)(=O)[O-])ccc3c(-c3ccccc3)c2c1.[Na+].[Na+] |
| InChI | InChI=1S/C26H18O6S2.2Na/c27-33(28,29)19-12-14-22-23(15-19)25(17-7-3-1-4-8-17)21-13-11-20(34(30,31)32)16-24(21)26(22)18-9-5-2-6-10-18;;/h1-16H,(H,27,28,29)(H,30,31,32);;/q;2*+1/p-2 |
| InChIKey | NVJKYQPGYSGEIR-UHFFFAOYSA-L |
| XLogP | -0.86 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|