C11H6BrF3N2O2 — CID 20513822
5-bromo-2-[3-(trifluoromethyl)phenyl]-1H-pyridazine-3,6-dione (PubChem CID 20513822) has the molecular formula C11H6BrF3N2O2 and a molecular weight of 335.08 g/mol. Its IUPAC name is 5-bromo-2-[3-(trifluoromethyl)phenyl]-1H-pyridazine-3,6-dione.
| Compound Name | 5-bromo-2-[3-(trifluoromethyl)phenyl]-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 20513822 |
| Molecular Formula | C11H6BrF3N2O2 |
| Molecular Weight | 335.08 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 5-bromo-2-[3-(trifluoromethyl)phenyl]-1H-pyridazine-3,6-dione |
| SMILES | O=c1[nH]n(-c2cccc(C(F)(F)F)c2)c(=O)cc1Br |
| InChI | InChI=1S/C11H6BrF3N2O2/c12-8-5-9(18)17(16-10(8)19)7-3-1-2-6(4-7)11(13,14)15/h1-5H,(H,16,19) |
| InChIKey | JDJGDRILOMHUGQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.08 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |