About 4-heptyl-2-pentyl-1,3-oxathiane
4-heptyl-2-pentyl-1,3-oxathiane (PubChem CID 20514300) has the molecular formula C16H32OS
and a molecular weight of 272.50 g/mol. Its IUPAC name is 4-heptyl-2-pentyl-1,3-oxathiane.
Molecular Properties
| Compound Name | 4-heptyl-2-pentyl-1,3-oxathiane |
| PubChem CID | 20514300 |
| Molecular Formula | C16H32OS |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | 4-heptyl-2-pentyl-1,3-oxathiane |
| SMILES | CCCCCCCC1CCOC(CCCCC)S1 |
| InChI | InChI=1S/C16H32OS/c1-3-5-7-8-10-11-15-13-14-17-16(18-15)12-9-6-4-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | JIMBGMLRZBXSKP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-heptyl-2-pentyl-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptyl-2-pentyl-1,3-oxathiane?
The IUPAC name of 4-heptyl-2-pentyl-1,3-oxathiane (CID 20514300) is 4-heptyl-2-pentyl-1,3-oxathiane.
What is the SMILES notation for 4-heptyl-2-pentyl-1,3-oxathiane?
The canonical SMILES for 4-heptyl-2-pentyl-1,3-oxathiane is CCCCCCCC1CCOC(CCCCC)S1.
What is the InChIKey of 4-heptyl-2-pentyl-1,3-oxathiane?
The InChIKey is JIMBGMLRZBXSKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32OS/c1-3-5-7-8-10-11-15-13-14-17-16(18-15)12-9-6-4-2/h15-16H,3-14H2,1-2H3.
What are the key properties of 4-heptyl-2-pentyl-1,3-oxathiane?
4-heptyl-2-pentyl-1,3-oxathiane has a molecular weight of 272.50 g/mol, XLogP of 5.78, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptyl-2-pentyl-1,3-oxathiane is sourced from PubChem (CID 20514300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).