About 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane
4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane (PubChem CID 20514302) has the molecular formula C13H18O2S
and a molecular weight of 238.35 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane |
| PubChem CID | 20514302 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane |
| SMILES | COc1ccc(C2CC(C)OC(C)S2)cc1 |
| InChI | InChI=1S/C13H18O2S/c1-9-8-13(16-10(2)15-9)11-4-6-12(14-3)7-5-11/h4-7,9-10,13H,8H2,1-3H3 |
| InChIKey | LNFHSXAQXQEFMY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane?
The IUPAC name of 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane (CID 20514302) is 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane.
What is the SMILES notation for 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane?
The canonical SMILES for 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane is COc1ccc(C2CC(C)OC(C)S2)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane?
The InChIKey is LNFHSXAQXQEFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2S/c1-9-8-13(16-10(2)15-9)11-4-6-12(14-3)7-5-11/h4-7,9-10,13H,8H2,1-3H3.
What are the key properties of 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane?
4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane has a molecular weight of 238.35 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-2,6-dimethyl-1,3-oxathiane is sourced from PubChem (CID 20514302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).