C14H24OS — CID 20514304
4-methyl-2-(2,6,6-trimethylcyclohex-2-en-1-yl)-1,3-oxathiane (PubChem CID 20514304) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is 4-methyl-2-(2,6,6-trimethylcyclohex-2-en-1-yl)-1,3-oxathiane.
| Compound Name | 4-methyl-2-(2,6,6-trimethylcyclohex-2-en-1-yl)-1,3-oxathiane |
|---|---|
| PubChem CID | 20514304 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-methyl-2-(2,6,6-trimethylcyclohex-2-en-1-yl)-1,3-oxathiane |
| SMILES | CC1=CCCC(C)(C)C1C1OCCC(C)S1 |
| InChI | InChI=1S/C14H24OS/c1-10-6-5-8-14(3,4)12(10)13-15-9-7-11(2)16-13/h6,11-13H,5,7-9H2,1-4H3 |
| InChIKey | HRVCRXQJAGIYOZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|