About 4-propyl-2-undecyl-1,3-oxathiane
4-propyl-2-undecyl-1,3-oxathiane (PubChem CID 20514327) has the molecular formula C18H36OS
and a molecular weight of 300.55 g/mol. Its IUPAC name is 4-propyl-2-undecyl-1,3-oxathiane.
Molecular Properties
| Compound Name | 4-propyl-2-undecyl-1,3-oxathiane |
| PubChem CID | 20514327 |
| Molecular Formula | C18H36OS |
| Molecular Weight | 300.55 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 4-propyl-2-undecyl-1,3-oxathiane |
| SMILES | CCCCCCCCCCCC1OCCC(CCC)S1 |
| InChI | InChI=1S/C18H36OS/c1-3-5-6-7-8-9-10-11-12-14-18-19-16-15-17(20-18)13-4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | WTZLICSXHGLRJY-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.55 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-propyl-2-undecyl-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-2-undecyl-1,3-oxathiane?
The IUPAC name of 4-propyl-2-undecyl-1,3-oxathiane (CID 20514327) is 4-propyl-2-undecyl-1,3-oxathiane.
What is the SMILES notation for 4-propyl-2-undecyl-1,3-oxathiane?
The canonical SMILES for 4-propyl-2-undecyl-1,3-oxathiane is CCCCCCCCCCCC1OCCC(CCC)S1.
What is the InChIKey of 4-propyl-2-undecyl-1,3-oxathiane?
The InChIKey is WTZLICSXHGLRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36OS/c1-3-5-6-7-8-9-10-11-12-14-18-19-16-15-17(20-18)13-4-2/h17-18H,3-16H2,1-2H3.
What are the key properties of 4-propyl-2-undecyl-1,3-oxathiane?
4-propyl-2-undecyl-1,3-oxathiane has a molecular weight of 300.55 g/mol, XLogP of 6.56, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-2-undecyl-1,3-oxathiane is sourced from PubChem (CID 20514327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).