About 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine
3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine (PubChem CID 20515389) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine |
| PubChem CID | 20515389 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine |
| SMILES | NCCCn1cnc2c1CCCC2 |
| InChI | InChI=1S/C10H17N3/c11-6-3-7-13-8-12-9-4-1-2-5-10(9)13/h8H,1-7,11H2 |
| InChIKey | APBFJYRABCTHKX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine?
The IUPAC name of 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine (CID 20515389) is 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine.
What is the SMILES notation for 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine?
The canonical SMILES for 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine is NCCCn1cnc2c1CCCC2.
What is the InChIKey of 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine?
The InChIKey is APBFJYRABCTHKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c11-6-3-7-13-8-12-9-4-1-2-5-10(9)13/h8H,1-7,11H2.
What are the key properties of 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine?
3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine has a molecular weight of 179.27 g/mol, XLogP of 1.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)propan-1-amine is sourced from PubChem (CID 20515389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).