About 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane
2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane (PubChem CID 20516367) has the molecular formula C30H35BrN2O6
and a molecular weight of 599.52 g/mol. Its IUPAC name is 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane.
Molecular Properties
| Compound Name | 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane |
| PubChem CID | 20516367 |
| Molecular Formula | C30H35BrN2O6 |
| Molecular Weight | 599.52 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane |
| SMILES | C.CC(=O)OCCOC(=O)c1cc(Br)c(N)c(CN2CCOCC2)c1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H21BrN2O5.C13H10O.CH4/c1-11(20)23-6-7-24-16(21)12-8-13(15(18)14(17)9-12)10-19-2-4-22-5-3-19;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h8-9H,2-7,10,18H2,1H3;1-10H;1H4 |
| InChIKey | FHSZNIAPSBQFPC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 599.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane?
The IUPAC name of 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane (CID 20516367) is 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane.
What is the SMILES notation for 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane?
The canonical SMILES for 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane is C.CC(=O)OCCOC(=O)c1cc(Br)c(N)c(CN2CCOCC2)c1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane?
The InChIKey is FHSZNIAPSBQFPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrN2O5.C13H10O.CH4/c1-11(20)23-6-7-24-16(21)12-8-13(15(18)14(17)9-12)10-19-2-4-22-5-3-19;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h8-9H,2-7,10,18H2,1H3;1-10H;1H4.
What are the key properties of 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane?
2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane has a molecular weight of 599.52 g/mol, XLogP of 5.14, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl 4-amino-3-bromo-5-(morpholin-4-ylmethyl)benzoate;diphenylmethanone;methane is sourced from PubChem (CID 20516367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).