C5H7N3O5 — CID 20516606
1-(1,2-dihydroxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 20516606) has the molecular formula C5H7N3O5 and a molecular weight of 189.13 g/mol. Its IUPAC name is 1-(1,2-dihydroxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(1,2-dihydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 20516606 |
| Molecular Formula | C5H7N3O5 |
| Molecular Weight | 189.13 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 1-(1,2-dihydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(C(O)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C5H7N3O5/c9-1-2(10)8-4(12)6-3(11)7-5(8)13/h2,9-10H,1H2,(H2,6,7,11,12,13) |
| InChIKey | HVFMOOWDHPBBCY-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.13 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |