About oxo(dipropoxy)silane
oxo(dipropoxy)silane (PubChem CID 20517230) has the molecular formula C6H14O3Si
and a molecular weight of 162.26 g/mol. Its IUPAC name is oxo(dipropoxy)silane.
Molecular Properties
| Compound Name | oxo(dipropoxy)silane |
| PubChem CID | 20517230 |
| Molecular Formula | C6H14O3Si |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | oxo(dipropoxy)silane |
| SMILES | CCCO[Si](=O)OCCC |
| InChI | InChI=1S/C6H14O3Si/c1-3-5-8-10(7)9-6-4-2/h3-6H2,1-2H3 |
| InChIKey | IXWYAUCTGSCECC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze oxo(dipropoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo(dipropoxy)silane?
The IUPAC name of oxo(dipropoxy)silane (CID 20517230) is oxo(dipropoxy)silane.
What is the SMILES notation for oxo(dipropoxy)silane?
The canonical SMILES for oxo(dipropoxy)silane is CCCO[Si](=O)OCCC.
What is the InChIKey of oxo(dipropoxy)silane?
The InChIKey is IXWYAUCTGSCECC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3Si/c1-3-5-8-10(7)9-6-4-2/h3-6H2,1-2H3.
What are the key properties of oxo(dipropoxy)silane?
oxo(dipropoxy)silane has a molecular weight of 162.26 g/mol, XLogP of 1.25, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxo(dipropoxy)silane is sourced from PubChem (CID 20517230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).