C20H43N — CID 20517292
2,4,4,6,6,8,8,10,10-nonamethylundecan-2-amine (PubChem CID 20517292) has the molecular formula C20H43N and a molecular weight of 297.57 g/mol. Its IUPAC name is 2,4,4,6,6,8,8,10,10-nonamethylundecan-2-amine.
| Compound Name | 2,4,4,6,6,8,8,10,10-nonamethylundecan-2-amine |
|---|---|
| PubChem CID | 20517292 |
| Molecular Formula | C20H43N |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 297.34 |
| IUPAC Name | 2,4,4,6,6,8,8,10,10-nonamethylundecan-2-amine |
| SMILES | CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C20H43N/c1-16(2,3)12-17(4,5)13-18(6,7)14-19(8,9)15-20(10,11)21/h12-15,21H2,1-11H3 |
| InChIKey | OSEWZBWXLMYGLT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |