About O-propyl (E)-3-phenylprop-2-enethioate
O-propyl (E)-3-phenylprop-2-enethioate (PubChem CID 20518035) has the molecular formula C12H14OS
and a molecular weight of 206.31 g/mol. Its IUPAC name is O-propyl (E)-3-phenylprop-2-enethioate.
Molecular Properties
| Compound Name | O-propyl (E)-3-phenylprop-2-enethioate |
| PubChem CID | 20518035 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | O-propyl (E)-3-phenylprop-2-enethioate |
| SMILES | CCCOC(=S)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H14OS/c1-2-10-13-12(14)9-8-11-6-4-3-5-7-11/h3-9H,2,10H2,1H3/b9-8+ |
| InChIKey | BUKCZSRAEUHESD-CMDGGOBGSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-propyl (E)-3-phenylprop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-propyl (E)-3-phenylprop-2-enethioate?
The IUPAC name of O-propyl (E)-3-phenylprop-2-enethioate (CID 20518035) is O-propyl (E)-3-phenylprop-2-enethioate.
What is the SMILES notation for O-propyl (E)-3-phenylprop-2-enethioate?
The canonical SMILES for O-propyl (E)-3-phenylprop-2-enethioate is CCCOC(=S)/C=C/c1ccccc1.
What is the InChIKey of O-propyl (E)-3-phenylprop-2-enethioate?
The InChIKey is BUKCZSRAEUHESD-CMDGGOBGSA-N. The full InChI is InChI=1S/C12H14OS/c1-2-10-13-12(14)9-8-11-6-4-3-5-7-11/h3-9H,2,10H2,1H3/b9-8+.
What are the key properties of O-propyl (E)-3-phenylprop-2-enethioate?
O-propyl (E)-3-phenylprop-2-enethioate has a molecular weight of 206.31 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-propyl (E)-3-phenylprop-2-enethioate is sourced from PubChem (CID 20518035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).