About (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine
(NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine (PubChem CID 20518214) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine |
| PubChem CID | 20518214 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine |
| SMILES | CC(C)/C(=N/O)n1cncn1 |
| InChI | InChI=1S/C6H10N4O/c1-5(2)6(9-11)10-4-7-3-8-10/h3-5,11H,1-2H3/b9-6- |
| InChIKey | MASPLWHNADRDEX-TWGQIWQCSA-N |
| XLogP | 0.57 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine (CID 20518214) is (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine is CC(C)/C(=N/O)n1cncn1.
What is the InChIKey of (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine?
The InChIKey is MASPLWHNADRDEX-TWGQIWQCSA-N. The full InChI is InChI=1S/C6H10N4O/c1-5(2)6(9-11)10-4-7-3-8-10/h3-5,11H,1-2H3/b9-6-.
What are the key properties of (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine?
(NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine has a molecular weight of 154.17 g/mol, XLogP of 0.57, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[2-methyl-1-(1,2,4-triazol-1-yl)propylidene]hydroxylamine is sourced from PubChem (CID 20518214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).