C8H11Cl3N4O — CID 20518282
(NZ)-N-[2,2-dimethyl-1-[3-(trichloromethyl)-1,2,4-triazol-1-yl]propylidene]hydroxylamine (PubChem CID 20518282) has the molecular formula C8H11Cl3N4O and a molecular weight of 285.56 g/mol. Its IUPAC name is (NZ)-N-[2,2-dimethyl-1-[3-(trichloromethyl)-1,2,4-triazol-1-yl]propylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2,2-dimethyl-1-[3-(trichloromethyl)-1,2,4-triazol-1-yl]propylidene]hydroxylamine |
|---|---|
| PubChem CID | 20518282 |
| Molecular Formula | C8H11Cl3N4O |
| Molecular Weight | 285.56 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | (NZ)-N-[2,2-dimethyl-1-[3-(trichloromethyl)-1,2,4-triazol-1-yl]propylidene]hydroxylamine |
| SMILES | CC(C)(C)/C(=N/O)n1cnc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C8H11Cl3N4O/c1-7(2,3)6(14-16)15-4-12-5(13-15)8(9,10)11/h4,16H,1-3H3/b14-6- |
| InChIKey | DOVOGPZJDSCDPO-NSIKDUERSA-N |
| XLogP | 2.79 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|