C18H14O4 — CID 20519037
4-[(1E,3E)-4-(4-carboxyphenyl)buta-1,3-dienyl]benzoic acid (PubChem CID 20519037) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(4-carboxyphenyl)buta-1,3-dienyl]benzoic acid.
| Compound Name | 4-[(1E,3E)-4-(4-carboxyphenyl)buta-1,3-dienyl]benzoic acid |
|---|---|
| PubChem CID | 20519037 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-[(1E,3E)-4-(4-carboxyphenyl)buta-1,3-dienyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=C/C=C/c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H14O4/c19-17(20)15-9-5-13(6-10-15)3-1-2-4-14-7-11-16(12-8-14)18(21)22/h1-12H,(H,19,20)(H,21,22)/b3-1+,4-2+ |
| InChIKey | AIOXYAOQMKDGIA-ZPUQHVIOSA-N |
| XLogP | 3.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|