About cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate
cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate (PubChem CID 20519518) has the molecular formula C17H20O2
and a molecular weight of 256.34 g/mol. Its IUPAC name is cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate |
| PubChem CID | 20519518 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate |
| SMILES | O=C(OCC1C=CCCC1)C1CC1c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c18-17(19-12-13-7-3-1-4-8-13)16-11-15(16)14-9-5-2-6-10-14/h2-3,5-7,9-10,13,15-16H,1,4,8,11-12H2 |
| InChIKey | KDJCUKIFYOQSFB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate?
The IUPAC name of cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate (CID 20519518) is cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate.
What is the SMILES notation for cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate?
The canonical SMILES for cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate is O=C(OCC1C=CCCC1)C1CC1c1ccccc1.
What is the InChIKey of cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate?
The InChIKey is KDJCUKIFYOQSFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O2/c18-17(19-12-13-7-3-1-4-8-13)16-11-15(16)14-9-5-2-6-10-14/h2-3,5-7,9-10,13,15-16H,1,4,8,11-12H2.
What are the key properties of cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate?
cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate has a molecular weight of 256.34 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-2-en-1-ylmethyl 2-phenylcyclopropane-1-carboxylate is sourced from PubChem (CID 20519518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).