About [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide
[(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide (PubChem CID 20519573) has the molecular formula C6H2N6O2
and a molecular weight of 190.12 g/mol. Its IUPAC name is [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide.
Molecular Properties
| Compound Name | [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide |
| PubChem CID | 20519573 |
| Molecular Formula | C6H2N6O2 |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide |
| SMILES | N#[N+]N=c1ccc(=O)c(=O)c1=NN=[N-] |
| InChI | InChI=1S/C6H2N6O2/c7-11-9-3-1-2-4(13)6(14)5(3)10-12-8/h1-2H |
| InChIKey | YTAZPEITCYOMCJ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 121.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide?
The IUPAC name of [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide (CID 20519573) is [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide.
What is the SMILES notation for [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide?
The canonical SMILES for [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide is N#[N+]N=c1ccc(=O)c(=O)c1=NN=[N-].
What is the InChIKey of [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide?
The InChIKey is YTAZPEITCYOMCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2N6O2/c7-11-9-3-1-2-4(13)6(14)5(3)10-12-8/h1-2H.
What are the key properties of [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide?
[(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide has a molecular weight of 190.12 g/mol, XLogP of -1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-diazonioimino-5,6-dioxocyclohex-3-en-1-ylidene)hydrazinylidene]azanide is sourced from PubChem (CID 20519573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).