About 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile
1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile (PubChem CID 20519664) has the molecular formula C12H5Cl3FN3O2S
and a molecular weight of 380.62 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile |
| PubChem CID | 20519664 |
| Molecular Formula | C12H5Cl3FN3O2S |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(-c2ccccc2F)c(=O)n(SC(Cl)(Cl)Cl)c1=O |
| InChI | InChI=1S/C12H5Cl3FN3O2S/c13-12(14,15)22-19-10(20)7(5-17)6-18(11(19)21)9-4-2-1-3-8(9)16/h1-4,6H |
| InChIKey | SLZCKLFPKYGMJO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile?
The IUPAC name of 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile (CID 20519664) is 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile.
What is the SMILES notation for 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile?
The canonical SMILES for 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile is N#Cc1cn(-c2ccccc2F)c(=O)n(SC(Cl)(Cl)Cl)c1=O.
What is the InChIKey of 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile?
The InChIKey is SLZCKLFPKYGMJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Cl3FN3O2S/c13-12(14,15)22-19-10(20)7(5-17)6-18(11(19)21)9-4-2-1-3-8(9)16/h1-4,6H.
What are the key properties of 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile?
1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile has a molecular weight of 380.62 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)-2,4-dioxo-3-(trichloromethylsulfanyl)pyrimidine-5-carbonitrile is sourced from PubChem (CID 20519664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).