About 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile
3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 20519671) has the molecular formula C16H14Cl2FN3O2S
and a molecular weight of 402.28 g/mol. Its IUPAC name is 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 20519671 |
| Molecular Formula | C16H14Cl2FN3O2S |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CCc1cccc(CC)c1-n1cc(C#N)c(=O)n(SC(F)(Cl)Cl)c1=O |
| InChI | InChI=1S/C16H14Cl2FN3O2S/c1-3-10-6-5-7-11(4-2)13(10)21-9-12(8-20)14(23)22(15(21)24)25-16(17,18)19/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | ROIHDGNRUTTYHE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile (CID 20519671) is 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile is CCc1cccc(CC)c1-n1cc(C#N)c(=O)n(SC(F)(Cl)Cl)c1=O.
What is the InChIKey of 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The InChIKey is ROIHDGNRUTTYHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2FN3O2S/c1-3-10-6-5-7-11(4-2)13(10)21-9-12(8-20)14(23)22(15(21)24)25-16(17,18)19/h5-7,9H,3-4H2,1-2H3.
What are the key properties of 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile?
3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile has a molecular weight of 402.28 g/mol, XLogP of 3.55, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[dichloro(fluoro)methyl]sulfanyl-1-(2,6-diethylphenyl)-2,4-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 20519671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).