About 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile
1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 20519698) has the molecular formula C11H6BrN3O2
and a molecular weight of 292.09 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 20519698 |
| Molecular Formula | C11H6BrN3O2 |
| Molecular Weight | 292.09 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(-c2ccccc2Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H6BrN3O2/c12-8-3-1-2-4-9(8)15-6-7(5-13)10(16)14-11(15)17/h1-4,6H,(H,14,16,17) |
| InChIKey | KWMSRSIAKSMABB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.09 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile (CID 20519698) is 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile is N#Cc1cn(-c2ccccc2Br)c(=O)[nH]c1=O.
What is the InChIKey of 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile?
The InChIKey is KWMSRSIAKSMABB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6BrN3O2/c12-8-3-1-2-4-9(8)15-6-7(5-13)10(16)14-11(15)17/h1-4,6H,(H,14,16,17).
What are the key properties of 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile?
1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile has a molecular weight of 292.09 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromophenyl)-2,4-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 20519698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).