C14H9Cl4N3O2S — CID 20519717
1-(2-methylphenyl)-2,4-dioxo-3-(1,1,2,2-tetrachloroethylsulfanyl)pyrimidine-5-carbonitrile (PubChem CID 20519717) has the molecular formula C14H9Cl4N3O2S and a molecular weight of 425.12 g/mol. Its IUPAC name is 1-(2-methylphenyl)-2,4-dioxo-3-(1,1,2,2-tetrachloroethylsulfanyl)pyrimidine-5-carbonitrile.
| Compound Name | 1-(2-methylphenyl)-2,4-dioxo-3-(1,1,2,2-tetrachloroethylsulfanyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 20519717 |
| Molecular Formula | C14H9Cl4N3O2S |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 422.92 |
| IUPAC Name | 1-(2-methylphenyl)-2,4-dioxo-3-(1,1,2,2-tetrachloroethylsulfanyl)pyrimidine-5-carbonitrile |
| SMILES | Cc1ccccc1-n1cc(C#N)c(=O)n(SC(Cl)(Cl)C(Cl)Cl)c1=O |
| InChI | InChI=1S/C14H9Cl4N3O2S/c1-8-4-2-3-5-10(8)20-7-9(6-19)11(22)21(13(20)23)24-14(17,18)12(15)16/h2-5,7,12H,1H3 |
| InChIKey | QNXCAQUNTDQMHD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|