C17H19Cl2N3 — CID 20519775
1,2-bis[(4-chlorophenyl)methyl]pyrazolidin-4-amine (PubChem CID 20519775) has the molecular formula C17H19Cl2N3 and a molecular weight of 336.27 g/mol. Its IUPAC name is 1,2-bis[(4-chlorophenyl)methyl]pyrazolidin-4-amine.
| Compound Name | 1,2-bis[(4-chlorophenyl)methyl]pyrazolidin-4-amine |
|---|---|
| PubChem CID | 20519775 |
| Molecular Formula | C17H19Cl2N3 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1,2-bis[(4-chlorophenyl)methyl]pyrazolidin-4-amine |
| SMILES | NC1CN(Cc2ccc(Cl)cc2)N(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H19Cl2N3/c18-15-5-1-13(2-6-15)9-21-11-17(20)12-22(21)10-14-3-7-16(19)8-4-14/h1-8,17H,9-12,20H2 |
| InChIKey | WOEOXFDPJZLQPH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |