C21H24ClN — CID 20519982
N-prop-2-enyl-3-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)propan-1-amine;hydrochloride (PubChem CID 20519982) has the molecular formula C21H24ClN and a molecular weight of 325.88 g/mol. Its IUPAC name is N-prop-2-enyl-3-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)propan-1-amine;hydrochloride.
| Compound Name | N-prop-2-enyl-3-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 20519982 |
| Molecular Formula | C21H24ClN |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-prop-2-enyl-3-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)propan-1-amine;hydrochloride |
| SMILES | C=CCNCCCC12CC(c3ccccc31)c1ccccc12.Cl |
| InChI | InChI=1S/C21H23N.ClH/c1-2-13-22-14-7-12-21-15-18(16-8-3-5-10-19(16)21)17-9-4-6-11-20(17)21;/h2-6,8-11,18,22H,1,7,12-15H2;1H |
| InChIKey | ROBQLRVTCMXYAJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|