About 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile
2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile (PubChem CID 2052) has the molecular formula C10H6N2O2
and a molecular weight of 186.17 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile |
| PubChem CID | 2052 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H6N2O2/c11-5-8(6-12)3-7-1-2-9(13)10(14)4-7/h1-4,13-14H |
| InChIKey | VTJXFTPMFYAJJU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile?
The IUPAC name of 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile (CID 2052) is 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile.
What is the SMILES notation for 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile?
The canonical SMILES for 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile is N#CC(C#N)=Cc1ccc(O)c(O)c1.
What is the InChIKey of 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile?
The InChIKey is VTJXFTPMFYAJJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2/c11-5-8(6-12)3-7-1-2-9(13)10(14)4-7/h1-4,13-14H.
What are the key properties of 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile?
2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile has a molecular weight of 186.17 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dihydroxyphenyl)methylidene]propanedinitrile is sourced from PubChem (CID 2052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).