About 1H-indole;2-methylnaphthalene
1H-indole;2-methylnaphthalene (PubChem CID 20520049) has the molecular formula C19H17N
and a molecular weight of 259.35 g/mol. Its IUPAC name is 1H-indole;2-methylnaphthalene.
Molecular Properties
| Compound Name | 1H-indole;2-methylnaphthalene |
| PubChem CID | 20520049 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1H-indole;2-methylnaphthalene |
| SMILES | Cc1ccc2ccccc2c1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C11H10.C8H7N/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-2-4-8-7(3-1)5-6-9-8/h2-8H,1H3;1-6,9H |
| InChIKey | LJRHCNSTOPRCOP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-indole;2-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;2-methylnaphthalene?
The IUPAC name of 1H-indole;2-methylnaphthalene (CID 20520049) is 1H-indole;2-methylnaphthalene.
What is the SMILES notation for 1H-indole;2-methylnaphthalene?
The canonical SMILES for 1H-indole;2-methylnaphthalene is Cc1ccc2ccccc2c1.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;2-methylnaphthalene?
The InChIKey is LJRHCNSTOPRCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C8H7N/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-2-4-8-7(3-1)5-6-9-8/h2-8H,1H3;1-6,9H.
What are the key properties of 1H-indole;2-methylnaphthalene?
1H-indole;2-methylnaphthalene has a molecular weight of 259.35 g/mol, XLogP of 5.32, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;2-methylnaphthalene is sourced from PubChem (CID 20520049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).