C4H8N2S3 — CID 20520331
ethane;1,3,4-thiadiazolidine-2,5-dithione (PubChem CID 20520331) has the molecular formula C4H8N2S3 and a molecular weight of 180.32 g/mol. Its IUPAC name is ethane;1,3,4-thiadiazolidine-2,5-dithione.
| Compound Name | ethane;1,3,4-thiadiazolidine-2,5-dithione |
|---|---|
| PubChem CID | 20520331 |
| Molecular Formula | C4H8N2S3 |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 179.98 |
| IUPAC Name | ethane;1,3,4-thiadiazolidine-2,5-dithione |
| SMILES | CC.S=c1[nH][nH]c(=S)s1 |
| InChI | InChI=1S/C2H2N2S3.C2H6/c5-1-3-4-2(6)7-1;1-2/h(H,3,5)(H,4,6);1-2H3 |
| InChIKey | AXJIMQRLKWKYJV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|