About N-butyl-6,7,10,11-tetramethyldodecan-4-amine
N-butyl-6,7,10,11-tetramethyldodecan-4-amine (PubChem CID 20520383) has the molecular formula C20H43N
and a molecular weight of 297.57 g/mol. Its IUPAC name is N-butyl-6,7,10,11-tetramethyldodecan-4-amine.
Molecular Properties
| Compound Name | N-butyl-6,7,10,11-tetramethyldodecan-4-amine |
| PubChem CID | 20520383 |
| Molecular Formula | C20H43N |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 297.34 |
| IUPAC Name | N-butyl-6,7,10,11-tetramethyldodecan-4-amine |
| SMILES | CCCCNC(CCC)CC(C)C(C)CCC(C)C(C)C |
| InChI | InChI=1S/C20H43N/c1-8-10-14-21-20(11-9-2)15-19(7)18(6)13-12-17(5)16(3)4/h16-21H,8-15H2,1-7H3 |
| InChIKey | UPAVAARJZUWWPN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6,7,10,11-tetramethyldodecan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6,7,10,11-tetramethyldodecan-4-amine?
The IUPAC name of N-butyl-6,7,10,11-tetramethyldodecan-4-amine (CID 20520383) is N-butyl-6,7,10,11-tetramethyldodecan-4-amine.
What is the SMILES notation for N-butyl-6,7,10,11-tetramethyldodecan-4-amine?
The canonical SMILES for N-butyl-6,7,10,11-tetramethyldodecan-4-amine is CCCCNC(CCC)CC(C)C(C)CCC(C)C(C)C.
What is the InChIKey of N-butyl-6,7,10,11-tetramethyldodecan-4-amine?
The InChIKey is UPAVAARJZUWWPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43N/c1-8-10-14-21-20(11-9-2)15-19(7)18(6)13-12-17(5)16(3)4/h16-21H,8-15H2,1-7H3.
What are the key properties of N-butyl-6,7,10,11-tetramethyldodecan-4-amine?
N-butyl-6,7,10,11-tetramethyldodecan-4-amine has a molecular weight of 297.57 g/mol, XLogP of 6.28, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6,7,10,11-tetramethyldodecan-4-amine is sourced from PubChem (CID 20520383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).