About 6-octoxyundecane
6-octoxyundecane (PubChem CID 20520524) has the molecular formula C19H40O
and a molecular weight of 284.53 g/mol. Its IUPAC name is 6-octoxyundecane.
Molecular Properties
| Compound Name | 6-octoxyundecane |
| PubChem CID | 20520524 |
| Molecular Formula | C19H40O |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.31 |
| IUPAC Name | 6-octoxyundecane |
| SMILES | CCCCCCCCOC(CCCCC)CCCCC |
| InChI | InChI=1S/C19H40O/c1-4-7-10-11-12-15-18-20-19(16-13-8-5-2)17-14-9-6-3/h19H,4-18H2,1-3H3 |
| InChIKey | WVROIPAADOYZKL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-octoxyundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-octoxyundecane?
The IUPAC name of 6-octoxyundecane (CID 20520524) is 6-octoxyundecane.
What is the SMILES notation for 6-octoxyundecane?
The canonical SMILES for 6-octoxyundecane is CCCCCCCCOC(CCCCC)CCCCC.
What is the InChIKey of 6-octoxyundecane?
The InChIKey is WVROIPAADOYZKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O/c1-4-7-10-11-12-15-18-20-19(16-13-8-5-2)17-14-9-6-3/h19H,4-18H2,1-3H3.
What are the key properties of 6-octoxyundecane?
6-octoxyundecane has a molecular weight of 284.53 g/mol, XLogP of 6.89, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-octoxyundecane is sourced from PubChem (CID 20520524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).