C18H17Cl2O4- — CID 20520803
2-[(7,8-dichloro-6-oxo-8a-propyl-8,9-dihydro-7H-fluoren-2-yl)oxy]acetate (PubChem CID 20520803) has the molecular formula C18H17Cl2O4- and a molecular weight of 368.24 g/mol. Its IUPAC name is 2-[(7,8-dichloro-6-oxo-8a-propyl-8,9-dihydro-7H-fluoren-2-yl)oxy]acetate.
| Compound Name | 2-[(7,8-dichloro-6-oxo-8a-propyl-8,9-dihydro-7H-fluoren-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 20520803 |
| Molecular Formula | C18H17Cl2O4- |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 2-[(7,8-dichloro-6-oxo-8a-propyl-8,9-dihydro-7H-fluoren-2-yl)oxy]acetate |
| SMILES | CCCC12Cc3cc(OCC(=O)[O-])ccc3C1=CC(=O)C(Cl)C2Cl |
| InChI | InChI=1S/C18H18Cl2O4/c1-2-5-18-8-10-6-11(24-9-15(22)23)3-4-12(10)13(18)7-14(21)16(19)17(18)20/h3-4,6-7,16-17H,2,5,8-9H2,1H3,(H,22,23)/p-1 |
| InChIKey | KMPFBCFTDMLIKD-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|