C14H18NO2+ — CID 20521327
2-tert-butyl-5-(4-methoxyphenyl)-1,2-oxazol-2-ium (PubChem CID 20521327) has the molecular formula C14H18NO2+ and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-tert-butyl-5-(4-methoxyphenyl)-1,2-oxazol-2-ium.
| Compound Name | 2-tert-butyl-5-(4-methoxyphenyl)-1,2-oxazol-2-ium |
|---|---|
| PubChem CID | 20521327 |
| Molecular Formula | C14H18NO2+ |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-tert-butyl-5-(4-methoxyphenyl)-1,2-oxazol-2-ium |
| SMILES | COc1ccc(-c2cc[n+](C(C)(C)C)o2)cc1 |
| InChI | InChI=1S/C14H18NO2/c1-14(2,3)15-10-9-13(17-15)11-5-7-12(16-4)8-6-11/h5-10H,1-4H3/q+1 |
| InChIKey | PBONFKZRVMQKKU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|