About 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate
2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate (PubChem CID 20521529) has the molecular formula C8H7Cl2NO3
and a molecular weight of 236.05 g/mol. Its IUPAC name is 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate.
Molecular Properties
| Compound Name | 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate |
| PubChem CID | 20521529 |
| Molecular Formula | C8H7Cl2NO3 |
| Molecular Weight | 236.05 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate |
| SMILES | Nc1c(Cl)cc(C(=O)C=O)cc1Cl.O |
| InChI | InChI=1S/C8H5Cl2NO2.H2O/c9-5-1-4(7(13)3-12)2-6(10)8(5)11;/h1-3H,11H2;1H2 |
| InChIKey | SAFBWLLTIPIZTP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.05 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate?
The IUPAC name of 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate (CID 20521529) is 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate.
What is the SMILES notation for 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate?
The canonical SMILES for 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate is Nc1c(Cl)cc(C(=O)C=O)cc1Cl.O.
What is the InChIKey of 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate?
The InChIKey is SAFBWLLTIPIZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2NO2.H2O/c9-5-1-4(7(13)3-12)2-6(10)8(5)11;/h1-3H,11H2;1H2.
What are the key properties of 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate?
2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate has a molecular weight of 236.05 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde;hydrate is sourced from PubChem (CID 20521529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).