C20H34N2 — CID 20521669
1-cyclopentyl-2,3,4,5-tetramethylideneundecane-1,10-diamine (PubChem CID 20521669) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 1-cyclopentyl-2,3,4,5-tetramethylideneundecane-1,10-diamine.
| Compound Name | 1-cyclopentyl-2,3,4,5-tetramethylideneundecane-1,10-diamine |
|---|---|
| PubChem CID | 20521669 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 1-cyclopentyl-2,3,4,5-tetramethylideneundecane-1,10-diamine |
| SMILES | C=C(CCCCC(C)N)C(=C)C(=C)C(=C)C(N)C1CCCC1 |
| InChI | InChI=1S/C20H34N2/c1-14(10-6-7-11-15(2)21)16(3)17(4)18(5)20(22)19-12-8-9-13-19/h15,19-20H,1,3-13,21-22H2,2H3 |
| InChIKey | PLJQQKSDVTVMBW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|