About copper bis(2,4,6-tribromophenolate)
copper bis(2,4,6-tribromophenolate) (PubChem CID 20521832) has the molecular formula C12H4Br6CuO2
and a molecular weight of 723.13 g/mol. Its IUPAC name is copper bis(2,4,6-tribromophenolate).
Molecular Properties
| Compound Name | copper bis(2,4,6-tribromophenolate) |
| PubChem CID | 20521832 |
| Molecular Formula | C12H4Br6CuO2 |
| Molecular Weight | 723.13 g/mol |
| Exact Mass | 716.46 |
| IUPAC Name | copper bis(2,4,6-tribromophenolate) |
| SMILES | [Cu+2].[O-]c1c(Br)cc(Br)cc1Br.[O-]c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/2C6H3Br3O.Cu/c2*7-3-1-4(8)6(10)5(9)2-3;/h2*1-2,10H;/q;;+2/p-2 |
| InChIKey | UVIRHVLVCNUHHS-UHFFFAOYSA-L |
| XLogP | 6.09 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 723.13 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper bis(2,4,6-tribromophenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(2,4,6-tribromophenolate)?
The IUPAC name of copper bis(2,4,6-tribromophenolate) (CID 20521832) is copper bis(2,4,6-tribromophenolate).
What is the SMILES notation for copper bis(2,4,6-tribromophenolate)?
The canonical SMILES for copper bis(2,4,6-tribromophenolate) is [Cu+2].[O-]c1c(Br)cc(Br)cc1Br.[O-]c1c(Br)cc(Br)cc1Br.
What is the InChIKey of copper bis(2,4,6-tribromophenolate)?
The InChIKey is UVIRHVLVCNUHHS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H3Br3O.Cu/c2*7-3-1-4(8)6(10)5(9)2-3;/h2*1-2,10H;/q;;+2/p-2.
What are the key properties of copper bis(2,4,6-tribromophenolate)?
copper bis(2,4,6-tribromophenolate) has a molecular weight of 723.13 g/mol, XLogP of 6.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(2,4,6-tribromophenolate) is sourced from PubChem (CID 20521832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).