About 2-azaspiro[3.3]heptane
2-azaspiro[3.3]heptane (PubChem CID 20521856) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is 2-azaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 2-azaspiro[3.3]heptane |
| PubChem CID | 20521856 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | 2-azaspiro[3.3]heptane |
| SMILES | C1CC2(C1)CNC2 |
| InChI | InChI=1S/C6H11N/c1-2-6(3-1)4-7-5-6/h7H,1-5H2 |
| InChIKey | QPEJAHMNOVMSOZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-azaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[3.3]heptane?
The IUPAC name of 2-azaspiro[3.3]heptane (CID 20521856) is 2-azaspiro[3.3]heptane.
What is the SMILES notation for 2-azaspiro[3.3]heptane?
The canonical SMILES for 2-azaspiro[3.3]heptane is C1CC2(C1)CNC2.
What is the InChIKey of 2-azaspiro[3.3]heptane?
The InChIKey is QPEJAHMNOVMSOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N/c1-2-6(3-1)4-7-5-6/h7H,1-5H2.
What are the key properties of 2-azaspiro[3.3]heptane?
2-azaspiro[3.3]heptane has a molecular weight of 97.16 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[3.3]heptane is sourced from PubChem (CID 20521856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).