About 1-fluorobut-3-en-2-amine
1-fluorobut-3-en-2-amine (PubChem CID 20521903) has the molecular formula C4H8FN
and a molecular weight of 89.11 g/mol. Its IUPAC name is 1-fluorobut-3-en-2-amine.
Molecular Properties
| Compound Name | 1-fluorobut-3-en-2-amine |
| PubChem CID | 20521903 |
| Molecular Formula | C4H8FN |
| Molecular Weight | 89.11 g/mol |
| Exact Mass | 89.06 |
| IUPAC Name | 1-fluorobut-3-en-2-amine |
| SMILES | C=CC(N)CF |
| InChI | InChI=1S/C4H8FN/c1-2-4(6)3-5/h2,4H,1,3,6H2 |
| InChIKey | DDMNKCNXQGQSSZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.11 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorobut-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorobut-3-en-2-amine?
The IUPAC name of 1-fluorobut-3-en-2-amine (CID 20521903) is 1-fluorobut-3-en-2-amine.
What is the SMILES notation for 1-fluorobut-3-en-2-amine?
The canonical SMILES for 1-fluorobut-3-en-2-amine is C=CC(N)CF.
What is the InChIKey of 1-fluorobut-3-en-2-amine?
The InChIKey is DDMNKCNXQGQSSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8FN/c1-2-4(6)3-5/h2,4H,1,3,6H2.
What are the key properties of 1-fluorobut-3-en-2-amine?
1-fluorobut-3-en-2-amine has a molecular weight of 89.11 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorobut-3-en-2-amine is sourced from PubChem (CID 20521903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).