About 1-fluorooct-7-en-2-amine
1-fluorooct-7-en-2-amine (PubChem CID 20521926) has the molecular formula C8H16FN
and a molecular weight of 145.22 g/mol. Its IUPAC name is 1-fluorooct-7-en-2-amine.
Molecular Properties
| Compound Name | 1-fluorooct-7-en-2-amine |
| PubChem CID | 20521926 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | 1-fluorooct-7-en-2-amine |
| SMILES | C=CCCCCC(N)CF |
| InChI | InChI=1S/C8H16FN/c1-2-3-4-5-6-8(10)7-9/h2,8H,1,3-7,10H2 |
| InChIKey | QXBJDFIKSIDXGJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorooct-7-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorooct-7-en-2-amine?
The IUPAC name of 1-fluorooct-7-en-2-amine (CID 20521926) is 1-fluorooct-7-en-2-amine.
What is the SMILES notation for 1-fluorooct-7-en-2-amine?
The canonical SMILES for 1-fluorooct-7-en-2-amine is C=CCCCCC(N)CF.
What is the InChIKey of 1-fluorooct-7-en-2-amine?
The InChIKey is QXBJDFIKSIDXGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FN/c1-2-3-4-5-6-8(10)7-9/h2,8H,1,3-7,10H2.
What are the key properties of 1-fluorooct-7-en-2-amine?
1-fluorooct-7-en-2-amine has a molecular weight of 145.22 g/mol, XLogP of 2.03, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorooct-7-en-2-amine is sourced from PubChem (CID 20521926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).