About 1,1-difluorohexan-2-amine
1,1-difluorohexan-2-amine (PubChem CID 20521929) has the molecular formula C6H13F2N
and a molecular weight of 137.17 g/mol. Its IUPAC name is 1,1-difluorohexan-2-amine.
Molecular Properties
| Compound Name | 1,1-difluorohexan-2-amine |
| PubChem CID | 20521929 |
| Molecular Formula | C6H13F2N |
| Molecular Weight | 137.17 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1,1-difluorohexan-2-amine |
| SMILES | CCCCC(N)C(F)F |
| InChI | InChI=1S/C6H13F2N/c1-2-3-4-5(9)6(7)8/h5-6H,2-4,9H2,1H3 |
| InChIKey | MKDFZUWRLXINJV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-difluorohexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluorohexan-2-amine?
The IUPAC name of 1,1-difluorohexan-2-amine (CID 20521929) is 1,1-difluorohexan-2-amine.
What is the SMILES notation for 1,1-difluorohexan-2-amine?
The canonical SMILES for 1,1-difluorohexan-2-amine is CCCCC(N)C(F)F.
What is the InChIKey of 1,1-difluorohexan-2-amine?
The InChIKey is MKDFZUWRLXINJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F2N/c1-2-3-4-5(9)6(7)8/h5-6H,2-4,9H2,1H3.
What are the key properties of 1,1-difluorohexan-2-amine?
1,1-difluorohexan-2-amine has a molecular weight of 137.17 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluorohexan-2-amine is sourced from PubChem (CID 20521929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).