About 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one
2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 20522014) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
Molecular Properties
| Compound Name | 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| PubChem CID | 20522014 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | CCC1OC2(CCNCC2)CN(C)C1=O |
| InChI | InChI=1S/C11H20N2O2/c1-3-9-10(14)13(2)8-11(15-9)4-6-12-7-5-11/h9,12H,3-8H2,1-2H3 |
| InChIKey | SWRPGNBWOPMSQD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The IUPAC name of 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (CID 20522014) is 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
What is the SMILES notation for 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The canonical SMILES for 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one is CCC1OC2(CCNCC2)CN(C)C1=O.
What is the InChIKey of 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The InChIKey is SWRPGNBWOPMSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-3-9-10(14)13(2)8-11(15-9)4-6-12-7-5-11/h9,12H,3-8H2,1-2H3.
What are the key properties of 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one has a molecular weight of 212.29 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one is sourced from PubChem (CID 20522014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).