About 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one
5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 20522027) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
Molecular Properties
| Compound Name | 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| PubChem CID | 20522027 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | CCCCC1NC(=O)COC12CCNCC2 |
| InChI | InChI=1S/C12H22N2O2/c1-2-3-4-10-12(5-7-13-8-6-12)16-9-11(15)14-10/h10,13H,2-9H2,1H3,(H,14,15) |
| InChIKey | VWEUTPRTOZKDHK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The IUPAC name of 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (CID 20522027) is 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
What is the SMILES notation for 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The canonical SMILES for 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one is CCCCC1NC(=O)COC12CCNCC2.
What is the InChIKey of 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The InChIKey is VWEUTPRTOZKDHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-2-3-4-10-12(5-7-13-8-6-12)16-9-11(15)14-10/h10,13H,2-9H2,1H3,(H,14,15).
What are the key properties of 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one has a molecular weight of 226.32 g/mol, XLogP of 0.81, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one is sourced from PubChem (CID 20522027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).