About 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one
9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 20522041) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
Molecular Properties
| Compound Name | 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| PubChem CID | 20522041 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1COC2(CCN(Cc3ccccc3)CC2)CN1 |
| InChI | InChI=1S/C15H20N2O2/c18-14-11-19-15(12-16-14)6-8-17(9-7-15)10-13-4-2-1-3-5-13/h1-5H,6-12H2,(H,16,18) |
| InChIKey | MUFUADWIRPMDDB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The IUPAC name of 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (CID 20522041) is 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
What is the SMILES notation for 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The canonical SMILES for 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one is O=C1COC2(CCN(Cc3ccccc3)CC2)CN1.
What is the InChIKey of 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The InChIKey is MUFUADWIRPMDDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c18-14-11-19-15(12-16-14)6-8-17(9-7-15)10-13-4-2-1-3-5-13/h1-5H,6-12H2,(H,16,18).
What are the key properties of 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one has a molecular weight of 260.34 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one is sourced from PubChem (CID 20522041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).