About 4-azaspiro[2.5]octane
4-azaspiro[2.5]octane (PubChem CID 20522183) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is 4-azaspiro[2.5]octane.
Molecular Properties
| Compound Name | 4-azaspiro[2.5]octane |
| PubChem CID | 20522183 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | 4-azaspiro[2.5]octane |
| SMILES | C1CCC2(CC2)NC1 |
| InChI | InChI=1S/C7H13N/c1-2-6-8-7(3-1)4-5-7/h8H,1-6H2 |
| InChIKey | HVFHYYCWZWCTMW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-azaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azaspiro[2.5]octane?
The IUPAC name of 4-azaspiro[2.5]octane (CID 20522183) is 4-azaspiro[2.5]octane.
What is the SMILES notation for 4-azaspiro[2.5]octane?
The canonical SMILES for 4-azaspiro[2.5]octane is C1CCC2(CC2)NC1.
What is the InChIKey of 4-azaspiro[2.5]octane?
The InChIKey is HVFHYYCWZWCTMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N/c1-2-6-8-7(3-1)4-5-7/h8H,1-6H2.
What are the key properties of 4-azaspiro[2.5]octane?
4-azaspiro[2.5]octane has a molecular weight of 111.19 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azaspiro[2.5]octane is sourced from PubChem (CID 20522183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).