C11H20ClNO3 — CID 20522323
(7-methyl-7-azabicyclo[2.2.1]heptan-2-yl) 2-hydroxy-2-methylpropanoate;hydrochloride (PubChem CID 20522323) has the molecular formula C11H20ClNO3 and a molecular weight of 249.74 g/mol. Its IUPAC name is (7-methyl-7-azabicyclo[2.2.1]heptan-2-yl) 2-hydroxy-2-methylpropanoate;hydrochloride.
| Compound Name | (7-methyl-7-azabicyclo[2.2.1]heptan-2-yl) 2-hydroxy-2-methylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 20522323 |
| Molecular Formula | C11H20ClNO3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (7-methyl-7-azabicyclo[2.2.1]heptan-2-yl) 2-hydroxy-2-methylpropanoate;hydrochloride |
| SMILES | CN1C2CCC1C(OC(=O)C(C)(C)O)C2.Cl |
| InChI | InChI=1S/C11H19NO3.ClH/c1-11(2,14)10(13)15-9-6-7-4-5-8(9)12(7)3;/h7-9,14H,4-6H2,1-3H3;1H |
| InChIKey | RLILDWSPGWMKEI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |